| MolName | 1-[(4-chlorophenyl)methyl]-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]piperidine-4-carboxamide |
| MolecularFormula | C20H20N3OCl3 |
| Smiles | O=C(C1CCN(Cc(cc2)ccc2Cl)CC1)N/N=C\c(cc1)cc(Cl)c1Cl |
| InChI | InChI=1S/C20H20Cl3N3O/c21-17-4-1-14(2-5-17)13-26-9-7-16(8-10-26)20(27)25-24-12-15-3-6-18(22)19(23)11-15/h1-6,11-12,16H,7-10,13H2,(H,25,27) |
| InChIK | MBJCJFLMZHJLGI-UHFFFAOYSA-N |
| TotalMolweight | 424.758 |
| Molweight | 424.758 |
| MonoisotopicMass | 423.067193 |
| CLogP | 5.2834 |
| CLogS | -6.021 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 311.35 |
| Relative PSA | 0.12706 |
| PolarSurfaceArea | 44.7 |
| Druglikeness | 9.2736 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.7037 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 7 |
| Symmetricatoms | 4 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-[(4-chlorophenyl)methyl]-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]piperidine-4-carboxamide | 2 - 1-[(4-chlorophenyl)methyl]-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]piperidine-4-carboxamide