| MolName | 6-N-naphthalen-1-yl-2-N,4-N-bis[(Z)-(4-nitrophenyl)methylideneamino]-1,3,5-triazine-2,4,6-triamine |
| MolecularFormula | C27H20N10O4 |
| Smiles | [O-][N+](c1ccc(/C=N\Nc2nc(Nc3cccc4ccccc34)nc(N/N=C\c(cc3)ccc3[N+]([O-])=O)n2)cc1)=O |
| InChI | InChI=1S/C27H20N10O4/c38-36(39)21-12-8-18(9-13-21)16-28-34-26-31-25(30-24-7-3-5-20-4-1-2-6-23(20)24)32-27(33-26)35-29-17-19-10-14-22(15-11-19)37(40)41/h1-17H,(H3,30,31,32,33,34,35) |
| InChIK | MBQVUCNRZDYRHT-UHFFFAOYSA-N |
| TotalMolweight | 548.522 |
| Molweight | 548.522 |
| MonoisotopicMass | 548.1669 |
| CLogP | 7.8142 |
| CLogS | -8.972 |
| H Acceptors | 14 |
| H Donors | 3 |
| TotalSurfaceArea | 414.66 |
| Relative PSA | 0.36452 |
| PolarSurfaceArea | 191.12 |
| Druglikeness | -2.9492 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.5122 |
| Fragments | 1 |
| Non HAtoms | 41 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 10 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 28 |
| Sp3Atoms | 2 |
| Symmetricatoms | 16 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 6-N-naphthalen-1-yl-2-N,4-N-bis[(Z)-(4-nitrophenyl)methylideneamino]-1,3,5-triazine-2,4,6-triamine | 2 - 6-N-naphthalen-1-yl-2-N,4-N-bis[(Z)-(4-nitrophenyl)methylideneamino]-1,3,5-triazine-2,4,6-triamine