| MolName | 3-[[4-chloro-5-[(Z)-(furan-2-carbonylhydrazinylidene)methyl]-2-oxo-1,3-thiazol-3-yl]methyl]benzoate |
| MolecularFormula | C17H11N3O5ClS |
| Smiles | [O-]C(c1cccc(CN(C(Cl)=C(/C=N\NC(c2ccco2)=O)S2)C2=O)c1)=O |
| InChI | InChI=1S/C17H12ClN3O5S/c18-14-13(8-19-20-15(22)12-5-2-6-26-12)27-17(25)21(14)9-10-3-1-4-11(7-10)16(23)24/h1-8H,9H2,(H,20,22)(H,23,24)/p-1 |
| InChIK | MCBICAFGJMQRBB-UHFFFAOYSA-M |
| TotalMolweight | 404.809 |
| Molweight | 404.809 |
| MonoisotopicMass | 404.010794 |
| CLogP | 0.1697 |
| CLogS | -5.023 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 286.1 |
| Relative PSA | 0.38979 |
| PolarSurfaceArea | 140.34 |
| Druglikeness | 7.457 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | polar activated DB; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.59259 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 3 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[[4-chloro-5-[(Z)-(furan-2-carbonylhydrazinylidene)methyl]-2-oxo-1,3-thiazol-3-yl]methyl]benzoate | 2 - 3-[[4-chloro-5-[(Z)-(furan-2-carbonylhydrazinylidene)methyl]-2-oxo-1,3-thiazol-3-yl]methyl]benzoate