| MolName | (Z)-N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-1-(3,4-dichlorophenyl)methanimine |
| MolecularFormula | C16H12N4Cl2S |
| Smiles | Clc(ccc(/C=N\n1c(SCc2ccccc2)nnc1)c1)c1Cl |
| InChI | InChI=1S/C16H12Cl2N4S/c17-14-7-6-13(8-15(14)18)9-20-22-11-19-21-16(22)23-10-12-4-2-1-3-5-12/h1-9,11H,10H2 |
| InChIK | MCHUAJGDFILURA-UHFFFAOYSA-N |
| TotalMolweight | 363.271 |
| Molweight | 363.271 |
| MonoisotopicMass | 362.01597 |
| CLogP | 4.6438 |
| CLogS | -7.98 |
| H Acceptors | 4 |
| TotalSurfaceArea | 266.35 |
| Relative PSA | 0.21705 |
| PolarSurfaceArea | 68.37 |
| Druglikeness | 3.9939 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-1-(3,4-dichlorophenyl)methanimine | 2 - (Z)-N-(3-benzylsulfanyl-1,2,4-triazol-4-yl)-1-(3,4-dichlorophenyl)methanimine