| MolName | 3-[4-[(Z)-(4-chlorophenyl)methylideneamino]-5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl]propanoic acid |
| MolecularFormula | C13H11N4O3ClS |
| Smiles | OC(CCC(C(N1/N=C\c(cc2)ccc2Cl)=O)=NNC1=S)=O |
| InChI | InChI=1S/C13H11ClN4O3S/c14-9-3-1-8(2-4-9)7-15-18-12(21)10(5-6-11(19)20)16-17-13(18)22/h1-4,7H,5-6H2,(H,17,22)(H,19,20) |
| InChIK | MCMMFPUGPKFFPR-UHFFFAOYSA-N |
| TotalMolweight | 338.774 |
| Molweight | 338.774 |
| MonoisotopicMass | 338.024038 |
| CLogP | 1.7486 |
| CLogS | -3.954 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 246.75 |
| Relative PSA | 0.42638 |
| PolarSurfaceArea | 126.45 |
| Druglikeness | 4.2564 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.63636 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[4-[(Z)-(4-chlorophenyl)methylideneamino]-5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl]propanoic acid | 2 - 3-[4-[(Z)-(4-chlorophenyl)methylideneamino]-5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl]propanoic acid