| MolName | 5-(2,4-dinitrophenyl)-N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-1,3,4-thiadiazol-2-amine |
| MolecularFormula | C13H7N7O7S |
| Smiles | [O-][N+](c1ccc(/C=N\Nc2nnc(-c(ccc([N+]([O-])=O)c3)c3[N+]([O-])=O)s2)o1)=O |
| InChI | InChI=1S/C13H7N7O7S/c21-18(22)7-1-3-9(10(5-7)19(23)24)12-15-17-13(28-12)16-14-6-8-2-4-11(27-8)20(25)26/h1-6H,(H,16,17) |
| InChIK | MCQZGLJSOALPEI-UHFFFAOYSA-N |
| TotalMolweight | 405.307 |
| Molweight | 405.307 |
| MonoisotopicMass | 405.012768 |
| CLogP | 2.2842 |
| CLogS | -5.24 |
| H Acceptors | 14 |
| H Donors | 1 |
| TotalSurfaceArea | 283.16 |
| Relative PSA | 0.60263 |
| PolarSurfaceArea | 229.01 |
| Druglikeness | 2.3663 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.60714 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 15 |
| Electronegative Atoms | 15 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 3 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 5-(2,4-dinitrophenyl)-N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-1,3,4-thiadiazol-2-amine | 2 - 5-(2,4-dinitrophenyl)-N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-1,3,4-thiadiazol-2-amine