| MolName | (Z)-N-(1,2,4-triazol-4-yl)-1-[4-[[(2S,3S)-3-[4-[(Z)-1,2,4-triazol-4-yliminomethyl]phenoxy]-1,4-dioxan-2-yl]oxy]phenyl]methanimine |
| MolecularFormula | C22H20N8O4 |
| Smiles | C(CO[C@H]1Oc2ccc(/C=N\n3cnnc3)cc2)O[C@H]1Oc1ccc(/C=N\n2cnnc2)cc1 |
| InChI | InChI=1S/C22H20N8O4/c1-5-19(6-2-17(1)11-27-29-13-23-24-14-29)33-21-22(32-10-9-31-21)34-20-7-3-18(4-8-20)12-28-30-15-25-26-16-30/h1-8,11-16,21-22H,9-10H2/t21-,22-/m0/s1 |
| InChIK | MCXDDDJUMICPED-VXKWHMMOSA-N |
| TotalMolweight | 460.453 |
| Molweight | 460.453 |
| MonoisotopicMass | 460.160752 |
| CLogP | 2.0512 |
| CLogS | -8.302 |
| H Acceptors | 12 |
| TotalSurfaceArea | 354.52 |
| Relative PSA | 0.34029 |
| PolarSurfaceArea | 123.06 |
| Druglikeness | -3.7363 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | low |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.64706 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| StereoCenters | 2 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 8 |
| Symmetricatoms | 21 |
| Aromatic Nitrogens | 6 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - (Z)-N-(1,2,4-triazol-4-yl)-1-[4-[[(2S,3S)-3-[4-[(Z)-1,2,4-triazol-4-yliminomethyl]phenoxy]-1,4-dioxan-2-yl]oxy]phenyl]methanimine | 2 - (Z)-N-(1,2,4-triazol-4-yl)-1-[4-[[(2S,3S)-3-[4-[(Z)-1,2,4-triazol-4-yliminomethyl]phenoxy]-1,4-dioxan-2-yl]oxy]phenyl]methanimine