| MolName | N'-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)oxamide |
| MolecularFormula | C19H16N4O4S |
| Smiles | N#Cc1c(NC(C(N/N=C\c(cc2)cc3c2OCO3)=O)=O)sc2c1CCCC2 |
| InChI | InChI=1S/C19H16N4O4S/c20-8-13-12-3-1-2-4-16(12)28-19(13)22-17(24)18(25)23-21-9-11-5-6-14-15(7-11)27-10-26-14/h5-7,9H,1-4,10H2,(H,22,24)(H,23,25) |
| InChIK | MDBDIAVIKROLND-UHFFFAOYSA-N |
| TotalMolweight | 396.426 |
| Molweight | 396.426 |
| MonoisotopicMass | 396.089226 |
| CLogP | 3.3039 |
| CLogS | -6.261 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 295.65 |
| Relative PSA | 0.38705 |
| PolarSurfaceArea | 141.05 |
| Druglikeness | -4.3956 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 7 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N'-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)oxamide | 2 - N'-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)oxamide