| MolName | (Z)-1-[1-(4-chlorophenyl)-2,5-diphenylpyrrol-3-yl]-N-(1,2,4-triazol-4-yl)methanimine |
| MolecularFormula | C25H18N5Cl |
| Smiles | Clc(cc1)ccc1-n1c(-c2ccccc2)c(/C=N\n2cnnc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C25H18ClN5/c26-22-11-13-23(14-12-22)31-24(19-7-3-1-4-8-19)15-21(16-29-30-17-27-28-18-30)25(31)20-9-5-2-6-10-20/h1-18H |
| InChIK | MDEGXIQGLCVKKQ-UHFFFAOYSA-N |
| TotalMolweight | 423.906 |
| Molweight | 423.906 |
| MonoisotopicMass | 423.125072 |
| CLogP | 5.5196 |
| CLogS | -10.915 |
| H Acceptors | 5 |
| TotalSurfaceArea | 328.4 |
| Relative PSA | 0.1437 |
| PolarSurfaceArea | 48 |
| Druglikeness | 4.7892 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.41935 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 28 |
| Symmetricatoms | 8 |
| Aromatic Nitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[1-(4-chlorophenyl)-2,5-diphenylpyrrol-3-yl]-N-(1,2,4-triazol-4-yl)methanimine | 2 - (Z)-1-[1-(4-chlorophenyl)-2,5-diphenylpyrrol-3-yl]-N-(1,2,4-triazol-4-yl)methanimine