| MolName | 4-[(Z)-[4-(furan-2-yl)-2-phenylimino-1,3-thiazol-3-yl]iminomethyl]benzonitrile |
| MolecularFormula | C21H14N4OS |
| Smiles | N#Cc1ccc(/C=N\N(C(c2ccco2)=CS2)/C2=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C21H14N4OS/c22-13-16-8-10-17(11-9-16)14-23-25-19(20-7-4-12-26-20)15-27-21(25)24-18-5-2-1-3-6-18/h1-12,14-15H |
| InChIK | MDNMXHJYODJVRY-UHFFFAOYSA-N |
| TotalMolweight | 370.435 |
| Molweight | 370.435 |
| MonoisotopicMass | 370.088831 |
| CLogP | 4.3884 |
| CLogS | -6.089 |
| H Acceptors | 5 |
| TotalSurfaceArea | 290.91 |
| Relative PSA | 0.24657 |
| PolarSurfaceArea | 90.19 |
| Druglikeness | -0.74949 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.55556 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[4-(furan-2-yl)-2-phenylimino-1,3-thiazol-3-yl]iminomethyl]benzonitrile | 2 - 4-[(Z)-[4-(furan-2-yl)-2-phenylimino-1,3-thiazol-3-yl]iminomethyl]benzonitrile