| MolName | (Z)-N-[4-(4-chlorophenyl)piperazin-1-yl]-1-(4-phenylmethoxyphenyl)methanimine |
| MolecularFormula | C24H24N3OCl |
| Smiles | Clc(cc1)ccc1N(CC1)CCN1/N=C\c(cc1)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C24H24ClN3O/c25-22-8-10-23(11-9-22)27-14-16-28(17-15-27)26-18-20-6-12-24(13-7-20)29-19-21-4-2-1-3-5-21/h1-13,18H,14-17,19H2 |
| InChIK | MDTDPCVBPXGMQV-UHFFFAOYSA-N |
| TotalMolweight | 405.928 |
| Molweight | 405.928 |
| MonoisotopicMass | 405.160789 |
| CLogP | 5.0502 |
| CLogS | -5.255 |
| H Acceptors | 4 |
| TotalSurfaceArea | 318.86 |
| Relative PSA | 0.089726 |
| PolarSurfaceArea | 28.07 |
| Druglikeness | 5.944 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.72414 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 7 |
| Symmetricatoms | 8 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-[4-(4-chlorophenyl)piperazin-1-yl]-1-(4-phenylmethoxyphenyl)methanimine | 2 - (Z)-N-[4-(4-chlorophenyl)piperazin-1-yl]-1-(4-phenylmethoxyphenyl)methanimine