| MolName | 3-(furan-2-yl)-4-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C15H11N5O3S |
| Smiles | [O-][N+](c1c(/C=C/C=N\N(C(c2ccco2)=NN2)C2=S)cccc1)=O |
| InChI | InChI=1S/C15H11N5O3S/c21-20(22)12-7-2-1-5-11(12)6-3-9-16-19-14(17-18-15(19)24)13-8-4-10-23-13/h1-10H,(H,18,24) |
| InChIK | MDTIRXOYFKDTLV-UHFFFAOYSA-N |
| TotalMolweight | 341.35 |
| Molweight | 341.35 |
| MonoisotopicMass | 341.05826 |
| CLogP | 1.5804 |
| CLogS | -4.885 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 261.58 |
| Relative PSA | 0.42266 |
| PolarSurfaceArea | 131.04 |
| Druglikeness | -1.5319 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.54167 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-(furan-2-yl)-4-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-1H-1,2,4-triazole-5-thione | 2 - 3-(furan-2-yl)-4-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-1H-1,2,4-triazole-5-thione