| MolName | 5-fluoro-4-morpholin-4-yl-N-[(Z)-(5-phenylfuran-2-yl)methylideneamino]pyrimidin-2-amine |
| MolecularFormula | C19H18N5O2F |
| Smiles | Fc1c(N2CCOCC2)nc(N/N=C\c2ccc(-c3ccccc3)o2)nc1 |
| InChI | InChI=1S/C19H18FN5O2/c20-16-13-21-19(23-18(16)25-8-10-26-11-9-25)24-22-12-15-6-7-17(27-15)14-4-2-1-3-5-14/h1-7,12-13H,8-11H2,(H,21,23,24) |
| InChIK | MDTPZHBMQDZUEO-UHFFFAOYSA-N |
| TotalMolweight | 367.383 |
| Molweight | 367.383 |
| MonoisotopicMass | 367.144453 |
| CLogP | 4.7073 |
| CLogS | -4.818 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 284.4 |
| Relative PSA | 0.25517 |
| PolarSurfaceArea | 75.78 |
| Druglikeness | 3.8347 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.62963 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 6 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 5-fluoro-4-morpholin-4-yl-N-[(Z)-(5-phenylfuran-2-yl)methylideneamino]pyrimidin-2-amine | 2 - 5-fluoro-4-morpholin-4-yl-N-[(Z)-(5-phenylfuran-2-yl)methylideneamino]pyrimidin-2-amine