| MolName | 2-(4-bromophenyl)-N-[(Z)-(2-chlorophenyl)methylideneamino]-6-phenylpyrimidin-4-amine |
| MolecularFormula | C23H16N4BrCl |
| Smiles | Clc1c(/C=N\Nc2cc(-c3ccccc3)nc(-c(cc3)ccc3Br)n2)cccc1 |
| InChI | InChI=1S/C23H16BrClN4/c24-19-12-10-17(11-13-19)23-27-21(16-6-2-1-3-7-16)14-22(28-23)29-26-15-18-8-4-5-9-20(18)25/h1-15H,(H,27,28,29) |
| InChIK | MDWRQMWRKGROMO-UHFFFAOYSA-N |
| TotalMolweight | 463.765 |
| Molweight | 463.765 |
| MonoisotopicMass | 462.024684 |
| CLogP | 8.3535 |
| CLogS | -8.163 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 320.33 |
| Relative PSA | 0.1402 |
| PolarSurfaceArea | 50.17 |
| Druglikeness | 0.59454 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51724 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-(4-bromophenyl)-N-[(Z)-(2-chlorophenyl)methylideneamino]-6-phenylpyrimidin-4-amine | 2 - 2-(4-bromophenyl)-N-[(Z)-(2-chlorophenyl)methylideneamino]-6-phenylpyrimidin-4-amine