| MolName | N-[(Z)-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]pyridine-2-carboxamide |
| MolecularFormula | C19H20N4O4 |
| Smiles | O=C(COc1ccc(/C=N\NC(c2ncccc2)=O)cc1)N1CCOCC1 |
| InChI | InChI=1S/C19H20N4O4/c24-18(23-9-11-26-12-10-23)14-27-16-6-4-15(5-7-16)13-21-22-19(25)17-3-1-2-8-20-17/h1-8,13H,9-12,14H2,(H,22,25) |
| InChIK | MEDWKXWWPQALQP-UHFFFAOYSA-N |
| TotalMolweight | 368.392 |
| Molweight | 368.392 |
| MonoisotopicMass | 368.148456 |
| CLogP | 1.5039 |
| CLogS | -2.44 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 289.1 |
| Relative PSA | 0.28907 |
| PolarSurfaceArea | 93.12 |
| Druglikeness | 6.0347 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.7037 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 7 |
| Symmetricatoms | 4 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]pyridine-2-carboxamide | 2 - N-[(Z)-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]pyridine-2-carboxamide