| MolName | N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-5-(furan-2-yl)-1H-pyrazole-3-carboxamide |
| MolecularFormula | C15H10N4O2Cl2 |
| Smiles | O=C(c1n[nH]c(-c2ccco2)c1)N/N=C\c(ccc(Cl)c1)c1Cl |
| InChI | InChI=1S/C15H10Cl2N4O2/c16-10-4-3-9(11(17)6-10)8-18-21-15(22)13-7-12(19-20-13)14-2-1-5-23-14/h1-8H,(H,19,20)(H,21,22) |
| InChIK | MEHZCGXPFGEOFL-UHFFFAOYSA-N |
| TotalMolweight | 349.176 |
| Molweight | 349.176 |
| MonoisotopicMass | 348.01808 |
| CLogP | 3.3371 |
| CLogS | -4.918 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 255.61 |
| Relative PSA | 0.29373 |
| PolarSurfaceArea | 83.28 |
| Druglikeness | 5.6923 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-5-(furan-2-yl)-1H-pyrazole-3-carboxamide | 2 - N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-5-(furan-2-yl)-1H-pyrazole-3-carboxamide