| MolName | 3-[(Z)-[(4-anilino-6-piperidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenol |
| MolecularFormula | C21H23N7O |
| Smiles | Oc1cc(/C=N\Nc2nc(N3CCCCC3)nc(Nc3ccccc3)n2)ccc1 |
| InChI | InChI=1S/C21H23N7O/c29-18-11-7-8-16(14-18)15-22-27-20-24-19(23-17-9-3-1-4-10-17)25-21(26-20)28-12-5-2-6-13-28/h1,3-4,7-11,14-15,29H,2,5-6,12-13H2,(H2,23,24,25,26,27) |
| InChIK | MEQYXIHPRRCVLW-UHFFFAOYSA-N |
| TotalMolweight | 389.462 |
| Molweight | 389.462 |
| MonoisotopicMass | 389.196408 |
| CLogP | 6.2802 |
| CLogS | -5.609 |
| H Acceptors | 8 |
| H Donors | 3 |
| TotalSurfaceArea | 308.69 |
| Relative PSA | 0.27209 |
| PolarSurfaceArea | 98.56 |
| Druglikeness | 2.7918 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51724 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 6 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-[(4-anilino-6-piperidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenol | 2 - 3-[(Z)-[(4-anilino-6-piperidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenol