| MolName | 3-[(Z)-(2,4-dichlorophenyl)methylideneamino]-6-(2-nitrophenyl)sulfanyl-5-phenylthieno[2,3-d]pyrimidin-4-one |
| MolecularFormula | C25H14N4O3Cl2S2 |
| Smiles | [O-][N+](c(cccc1)c1Sc(sc(N=CN1/N=C\c(ccc(Cl)c2)c2Cl)c2C1=O)c2-c1ccccc1)=O |
| InChI | InChI=1S/C25H14Cl2N4O3S2/c26-17-11-10-16(18(27)12-17)13-29-30-14-28-23-22(24(30)32)21(15-6-2-1-3-7-15)25(36-23)35-20-9-5-4-8-19(20)31(33)34/h1-14H |
| InChIK | MERNKABJMFHJGC-UHFFFAOYSA-N |
| TotalMolweight | 553.449 |
| Molweight | 553.449 |
| MonoisotopicMass | 551.988435 |
| CLogP | 6.4214 |
| CLogS | -9.67 |
| H Acceptors | 7 |
| TotalSurfaceArea | 384.55 |
| Relative PSA | 0.28054 |
| PolarSurfaceArea | 144.39 |
| Druglikeness | 0.64967 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.47222 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-(2,4-dichlorophenyl)methylideneamino]-6-(2-nitrophenyl)sulfanyl-5-phenylthieno[2,3-d]pyrimidin-4-one | 2 - 3-[(Z)-(2,4-dichlorophenyl)methylideneamino]-6-(2-nitrophenyl)sulfanyl-5-phenylthieno[2,3-d]pyrimidin-4-one