| MolName | N-[5-[2-[(2E)-2-[(3-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]benzamide |
| MolecularFormula | C18H15N5O3S |
| Smiles | Oc1cccc(/C=N/NC(Cc2nnc(NC(c3ccccc3)=O)s2)=O)c1 |
| InChI | InChI=1S/C18H15N5O3S/c24-14-8-4-5-12(9-14)11-19-21-15(25)10-16-22-23-18(27-16)20-17(26)13-6-2-1-3-7-13/h1-9,11,24H,10H2,(H,21,25)(H,20,23,26) |
| InChIK | MEYYLBYLWUESTG-UHFFFAOYSA-N |
| TotalMolweight | 381.415 |
| Molweight | 381.415 |
| MonoisotopicMass | 381.08956 |
| CLogP | 2.8445 |
| CLogS | -4.109 |
| H Acceptors | 8 |
| H Donors | 3 |
| TotalSurfaceArea | 289.53 |
| Relative PSA | 0.40034 |
| PolarSurfaceArea | 144.81 |
| Druglikeness | 6.4758 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[5-[2-[(2E)-2-[(3-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]benzamide | 2 - N-[5-[2-[(2E)-2-[(3-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]benzamide