| MolName | N-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]-3-morpholin-4-ylsulfonylbenzamide |
| MolecularFormula | C18H17N4O6ClS |
| Smiles | [O-][N+](c(cc(/C=N\NC(c1cc(S(N2CCOCC2)(=O)=O)ccc1)=O)cc1)c1Cl)=O |
| InChI | InChI=1S/C18H17ClN4O6S/c19-16-5-4-13(10-17(16)23(25)26)12-20-21-18(24)14-2-1-3-15(11-14)30(27,28)22-6-8-29-9-7-22/h1-5,10-12H,6-9H2,(H,21,24) |
| InChIK | MFORQUCCCUWWAZ-UHFFFAOYSA-N |
| TotalMolweight | 452.874 |
| Molweight | 452.874 |
| MonoisotopicMass | 452.055733 |
| CLogP | 1.9288 |
| CLogS | -4.123 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 316.5 |
| Relative PSA | 0.343 |
| PolarSurfaceArea | 142.27 |
| Druglikeness | -7.2218 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.56667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 7 |
| Symmetricatoms | 3 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]-3-morpholin-4-ylsulfonylbenzamide | 2 - N-[(Z)-(4-chloro-3-nitrophenyl)methylideneamino]-3-morpholin-4-ylsulfonylbenzamide