| MolName | 4-N,6-N-diphenyl-2-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-1,3,5-triazine-2,4,6-triamine |
| MolecularFormula | C24H21N7 |
| Smiles | C(/C=N\Nc1nc(Nc2ccccc2)nc(Nc2ccccc2)n1)=C/c1ccccc1 |
| InChI | InChI=1S/C24H21N7/c1-4-11-19(12-5-1)13-10-18-25-31-24-29-22(26-20-14-6-2-7-15-20)28-23(30-24)27-21-16-8-3-9-17-21/h1-18H,(H3,26,27,28,29,30,31) |
| InChIK | MGBGHOVQTPJKHD-UHFFFAOYSA-N |
| TotalMolweight | 407.48 |
| Molweight | 407.48 |
| MonoisotopicMass | 407.185843 |
| CLogP | 7.3416 |
| CLogS | -6.783 |
| H Acceptors | 7 |
| H Donors | 3 |
| TotalSurfaceArea | 334.46 |
| Relative PSA | 0.2356 |
| PolarSurfaceArea | 87.12 |
| Druglikeness | 2.4561 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.54839 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Symmetricatoms | 13 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 4-N,6-N-diphenyl-2-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-1,3,5-triazine-2,4,6-triamine | 2 - 4-N,6-N-diphenyl-2-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-1,3,5-triazine-2,4,6-triamine