| MolName | N-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]pyridin-2-amine |
| MolecularFormula | C14H16N4OS |
| Smiles | C(COCC1)N1c1ccc(/C=N\Nc2ncccc2)s1 |
| InChI | InChI=1S/C14H16N4OS/c1-2-6-15-13(3-1)17-16-11-12-4-5-14(20-12)18-7-9-19-10-8-18/h1-6,11H,7-10H2,(H,15,17) |
| InChIK | MGKILVBTSJYVAL-UHFFFAOYSA-N |
| TotalMolweight | 288.374 |
| Molweight | 288.374 |
| MonoisotopicMass | 288.104481 |
| CLogP | 3.9166 |
| CLogS | -3.142 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 225.78 |
| Relative PSA | 0.30051 |
| PolarSurfaceArea | 77.99 |
| Druglikeness | 4.575 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.7 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]pyridin-2-amine | 2 - N-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]pyridin-2-amine