| MolName | [2-[(Z)-[(2-hydroxy-2,2-diphenylacetyl)hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| MolecularFormula | C29H22N2O6 |
| Smiles | OC(C(N/N=C\c(cccc1)c1OC(c(cc1)cc2c1OCO2)=O)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H22N2O6/c32-27(20-15-16-25-26(17-20)36-19-35-25)37-24-14-8-7-9-21(24)18-30-31-28(33)29(34,22-10-3-1-4-11-22)23-12-5-2-6-13-23/h1-18,34H,19H2,(H,31,33) |
| InChIK | MGPYFIUHASZJTO-UHFFFAOYSA-N |
| TotalMolweight | 494.502 |
| Molweight | 494.502 |
| MonoisotopicMass | 494.147788 |
| CLogP | 5.0238 |
| CLogS | -6.608 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 371.28 |
| Relative PSA | 0.2482 |
| PolarSurfaceArea | 106.45 |
| Druglikeness | 5.1208 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.48649 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 6 |
| Symmetricatoms | 8 |
| StereoCon |
Click to Load Molecule:
1 - [2-[(Z)-[(2-hydroxy-2,2-diphenylacetyl)hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate | 2 - [2-[(Z)-[(2-hydroxy-2,2-diphenylacetyl)hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate