| MolName | 3-[(2Z)-2-[(2-fluorophenyl)methylidene]hydrazinyl]-1H-quinoxalin-2-one |
| MolecularFormula | C15H11N4OF |
| Smiles | O=C1Nc(cccc2)c2N=C1N/N=C\c(cccc1)c1F |
| InChI | InChI=1S/C15H11FN4O/c16-11-6-2-1-5-10(11)9-17-20-14-15(21)19-13-8-4-3-7-12(13)18-14/h1-9H,(H,18,20)(H,19,21) |
| InChIK | MGRBQRLFVADMDN-UHFFFAOYSA-N |
| TotalMolweight | 282.277 |
| Molweight | 282.277 |
| MonoisotopicMass | 282.091689 |
| CLogP | 1.585 |
| CLogS | -3.971 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 214.27 |
| Relative PSA | 0.27526 |
| PolarSurfaceArea | 65.85 |
| Druglikeness | 3.2945 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.61905 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 2 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(2Z)-2-[(2-fluorophenyl)methylidene]hydrazinyl]-1H-quinoxalin-2-one | 2 - 3-[(2Z)-2-[(2-fluorophenyl)methylidene]hydrazinyl]-1H-quinoxalin-2-one