| MolName | N-[(Z)-[5-[(4-cyanophenoxy)methyl]furan-2-yl]methylideneamino]-2-naphthalen-2-yloxyacetamide |
| MolecularFormula | C25H19N3O4 |
| Smiles | N#Cc(cc1)ccc1OCc1ccc(/C=N\NC(COc2cc3ccccc3cc2)=O)o1 |
| InChI | InChI=1S/C25H19N3O4/c26-14-18-5-8-21(9-6-18)30-16-24-12-11-23(32-24)15-27-28-25(29)17-31-22-10-7-19-3-1-2-4-20(19)13-22/h1-13,15H,16-17H2,(H,28,29) |
| InChIK | MGTQCVBUAXPVQL-UHFFFAOYSA-N |
| TotalMolweight | 425.443 |
| Molweight | 425.443 |
| MonoisotopicMass | 425.137557 |
| CLogP | 4.3973 |
| CLogS | -6.927 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 340.27 |
| Relative PSA | 0.24592 |
| PolarSurfaceArea | 96.85 |
| Druglikeness | 2.1203 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.71875 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-[(4-cyanophenoxy)methyl]furan-2-yl]methylideneamino]-2-naphthalen-2-yloxyacetamide | 2 - N-[(Z)-[5-[(4-cyanophenoxy)methyl]furan-2-yl]methylideneamino]-2-naphthalen-2-yloxyacetamide