| MolName | N-[(2E,4E)-1-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide |
| MolecularFormula | C25H20N3O2Cl |
| Smiles | O=C(/C(/NC(c1ccccc1)=O)=C\C=C\c1ccccc1)N/N=C\c(cc1)ccc1Cl |
| InChI | InChI=1S/C25H20ClN3O2/c26-22-16-14-20(15-17-22)18-27-29-25(31)23(13-7-10-19-8-3-1-4-9-19)28-24(30)21-11-5-2-6-12-21/h1-18H,(H,28,30)(H,29,31) |
| InChIK | MGXWQTWUORMQEL-UHFFFAOYSA-N |
| TotalMolweight | 429.906 |
| Molweight | 429.906 |
| MonoisotopicMass | 429.124404 |
| CLogP | 6.0809 |
| CLogS | -6.514 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 342.59 |
| Relative PSA | 0.17663 |
| PolarSurfaceArea | 70.56 |
| Druglikeness | 6.5172 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54839 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Symmetricatoms | 6 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(2E,4E)-1-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide | 2 - N-[(2E,4E)-1-[(2Z)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide