| MolName | 2-(2-amino-1,3-thiazol-4-yl)-N-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]acetamide |
| MolecularFormula | C10H9N5O3S2 |
| Smiles | Nc1nc(CC(N/N=C\c2ccc([N+]([O-])=O)s2)=O)cs1 |
| InChI | InChI=1S/C10H9N5O3S2/c11-10-13-6(5-19-10)3-8(16)14-12-4-7-1-2-9(20-7)15(17)18/h1-2,4-5H,3H2,(H2,11,13)(H,14,16) |
| InChIK | MHBSDJSGYBEKJT-UHFFFAOYSA-N |
| TotalMolweight | 311.345 |
| Molweight | 311.345 |
| MonoisotopicMass | 311.01468 |
| CLogP | 1.1659 |
| CLogS | -4.139 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 223.58 |
| Relative PSA | 0.59661 |
| PolarSurfaceArea | 182.67 |
| Druglikeness | 2.114 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.7 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 2 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(2-amino-1,3-thiazol-4-yl)-N-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]acetamide | 2 - 2-(2-amino-1,3-thiazol-4-yl)-N-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]acetamide