| MolName | (2R)-N-[(Z)-benzylideneamino]-2-phenoxy-2-phenylacetamide |
| MolecularFormula | C21H18N2O2 |
| Smiles | O=C([C@@H](c1ccccc1)Oc1ccccc1)N/N=C\c1ccccc1 |
| InChI | InChI=1S/C21H18N2O2/c24-21(23-22-16-17-10-4-1-5-11-17)20(18-12-6-2-7-13-18)25-19-14-8-3-9-15-19/h1-16,20H,(H,23,24)/t20-/m1/s1 |
| InChIK | MHHWUHZTOXRQSE-HXUWFJFHSA-N |
| TotalMolweight | 330.386 |
| Molweight | 330.386 |
| MonoisotopicMass | 330.136828 |
| CLogP | 4.075 |
| CLogS | -4.595 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 269.25 |
| Relative PSA | 0.17088 |
| PolarSurfaceArea | 50.69 |
| Druglikeness | 5.2046 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.56 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| StereoCenters | 1 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 6 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - (2R)-N-[(Z)-benzylideneamino]-2-phenoxy-2-phenylacetamide | 2 - (2R)-N-[(Z)-benzylideneamino]-2-phenoxy-2-phenylacetamide