| MolName | N-[(Z)-(2,4-dibromo-5-hydroxyphenyl)methylideneamino]-3-hydroxynaphthalene-2-carboxamide |
| MolecularFormula | C18H12N2O3Br2 |
| Smiles | Oc1cc2ccccc2cc1C(N/N=C\c(c(Br)c1)cc(O)c1Br)=O |
| InChI | InChI=1S/C18H12Br2N2O3/c19-14-8-15(20)17(24)7-12(14)9-21-22-18(25)13-5-10-3-1-2-4-11(10)6-16(13)23/h1-9,23-24H,(H,22,25) |
| InChIK | MHOOWHPUFYECDF-UHFFFAOYSA-N |
| TotalMolweight | 464.112 |
| Molweight | 464.112 |
| MonoisotopicMass | 461.921465 |
| CLogP | 5.155 |
| CLogS | -6.403 |
| H Acceptors | 5 |
| H Donors | 3 |
| TotalSurfaceArea | 271.55 |
| Relative PSA | 0.22909 |
| PolarSurfaceArea | 81.92 |
| Druglikeness | 2.6304 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2,4-dibromo-5-hydroxyphenyl)methylideneamino]-3-hydroxynaphthalene-2-carboxamide | 2 - N-[(Z)-(2,4-dibromo-5-hydroxyphenyl)methylideneamino]-3-hydroxynaphthalene-2-carboxamide