| MolName | N-[(Z)-[4-(2,4-dinitrophenoxy)phenyl]methylideneamino]-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide |
| MolecularFormula | C20H9N4O6F13 |
| Smiles | [O-][N+](c(cc1)cc([N+]([O-])=O)c1Oc1ccc(/C=N\NC(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)=O)cc1)=O |
| InChI | InChI=1S/C20H9F13N4O6/c21-15(22,16(23,24)17(25,26)18(27,28)19(29,30)20(31,32)33)14(38)35-34-8-9-1-4-11(5-2-9)43-13-6-3-10(36(39)40)7-12(13)37(41)42/h1-8H,(H,35,38) |
| InChIK | MHRAHWHCDGSLSC-UHFFFAOYSA-N |
| TotalMolweight | 648.287 |
| Molweight | 648.287 |
| MonoisotopicMass | 648.03145 |
| CLogP | 5.3395 |
| CLogS | -10.098 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 389.34 |
| Relative PSA | 0.27444 |
| PolarSurfaceArea | 142.33 |
| Druglikeness | -117.64 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51163 |
| Fragments | 1 |
| Non HAtoms | 43 |
| NonCHAtoms | 23 |
| Electronegative Atoms | 23 |
| Rotatable Bond | 12 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 9 |
| Symmetricatoms | 9 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-(2,4-dinitrophenoxy)phenyl]methylideneamino]-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide | 2 - N-[(Z)-[4-(2,4-dinitrophenoxy)phenyl]methylideneamino]-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide