| MolName | 1-(benzenesulfonyl)-N-[(Z)-(4-fluorophenyl)methylideneamino]piperidine-4-carboxamide |
| MolecularFormula | C19H20N3O3FS |
| Smiles | O=C(C(CC1)CCN1S(c1ccccc1)(=O)=O)N/N=C\c(cc1)ccc1F |
| InChI | InChI=1S/C19H20FN3O3S/c20-17-8-6-15(7-9-17)14-21-22-19(24)16-10-12-23(13-11-16)27(25,26)18-4-2-1-3-5-18/h1-9,14,16H,10-13H2,(H,22,24) |
| InChIK | MHSSMACHSISSTF-UHFFFAOYSA-N |
| TotalMolweight | 389.45 |
| Molweight | 389.45 |
| MonoisotopicMass | 389.12094 |
| CLogP | 3.0171 |
| CLogS | -3.752 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 286.26 |
| Relative PSA | 0.23804 |
| PolarSurfaceArea | 87.22 |
| Druglikeness | -0.3324 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 6 |
| Symmetricatoms | 7 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-(benzenesulfonyl)-N-[(Z)-(4-fluorophenyl)methylideneamino]piperidine-4-carboxamide | 2 - 1-(benzenesulfonyl)-N-[(Z)-(4-fluorophenyl)methylideneamino]piperidine-4-carboxamide