| MolName | [3-benzoyloxy-4-[(Z)-[(3-bromobenzoyl)hydrazinylidene]methyl]phenyl] benzoate |
| MolecularFormula | C28H19N2O5Br |
| Smiles | O=C(c1cccc(Br)c1)N/N=C\c(ccc(OC(c1ccccc1)=O)c1)c1OC(c1ccccc1)=O |
| InChI | InChI=1S/C28H19BrN2O5/c29-23-13-7-12-21(16-23)26(32)31-30-18-22-14-15-24(35-27(33)19-8-3-1-4-9-19)17-25(22)36-28(34)20-10-5-2-6-11-20/h1-18H,(H,31,32) |
| InChIK | MHVSUEFPZDTBHU-UHFFFAOYSA-N |
| TotalMolweight | 543.372 |
| Molweight | 543.372 |
| MonoisotopicMass | 542.047734 |
| CLogP | 6.7878 |
| CLogS | -7.495 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 380.64 |
| Relative PSA | 0.21566 |
| PolarSurfaceArea | 94.06 |
| Druglikeness | 2.2076 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - [3-benzoyloxy-4-[(Z)-[(3-bromobenzoyl)hydrazinylidene]methyl]phenyl] benzoate | 2 - [3-benzoyloxy-4-[(Z)-[(3-bromobenzoyl)hydrazinylidene]methyl]phenyl] benzoate