| MolName | (Z,E)-3-phenyl-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]prop-2-en-1-imine |
| MolecularFormula | C18H16N2 |
| Smiles | C(/C=N\N=C/C=C/c1ccccc1)=C/c1ccccc1 |
| InChI | InChI=1S/C18H16N2/c1-3-9-17(10-4-1)13-7-15-19-20-16-8-14-18-11-5-2-6-12-18/h1-16H |
| InChIK | MIBXLDBZXACZIE-UHFFFAOYSA-N |
| TotalMolweight | 260.339 |
| Molweight | 260.339 |
| MonoisotopicMass | 260.131348 |
| CLogP | 4.8222 |
| CLogS | -4.716 |
| H Acceptors | 2 |
| TotalSurfaceArea | 235.54 |
| Relative PSA | 0.097733 |
| PolarSurfaceArea | 24.72 |
| Druglikeness | 1.6579 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.8 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 2 |
| Electronegative Atoms | 2 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Symmetricatoms | 12 |
| StereoCon |
Click to Load Molecule:
1 - (Z,E)-3-phenyl-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]prop-2-en-1-imine | 2 - (Z,E)-3-phenyl-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]prop-2-en-1-imine