| MolName | N-[(Z)-(2-chlorophenyl)methylideneamino]quinolin-8-amine |
| MolecularFormula | C16H12N3Cl |
| Smiles | Clc1c(/C=N\Nc2cccc3cccnc23)cccc1 |
| InChI | InChI=1S/C16H12ClN3/c17-14-8-2-1-5-13(14)11-19-20-15-9-3-6-12-7-4-10-18-16(12)15/h1-11,20H |
| InChIK | MIERSFZDOYLKFQ-UHFFFAOYSA-N |
| TotalMolweight | 281.745 |
| Molweight | 281.745 |
| MonoisotopicMass | 281.071974 |
| CLogP | 5.7629 |
| CLogS | -4.591 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 218.02 |
| Relative PSA | 0.15567 |
| PolarSurfaceArea | 37.28 |
| Druglikeness | 2.3845 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-chlorophenyl)methylideneamino]quinolin-8-amine | 2 - N-[(Z)-(2-chlorophenyl)methylideneamino]quinolin-8-amine