| MolName | 2-[(Z)-[5-sulfanylidene-3-(trifluoromethyl)-1H-1,2,4-triazol-4-yl]iminomethyl]benzoic acid |
| MolecularFormula | C11H7N4O2F3S |
| Smiles | OC(c1c(/C=N\N(C(C(F)(F)F)=NN2)C2=S)cccc1)=O |
| InChI | InChI=1S/C11H7F3N4O2S/c12-11(13,14)9-16-17-10(21)18(9)15-5-6-3-1-2-4-7(6)8(19)20/h1-5H,(H,17,21)(H,19,20) |
| InChIK | MIYIRGYGJVVREI-UHFFFAOYSA-N |
| TotalMolweight | 316.263 |
| Molweight | 316.263 |
| MonoisotopicMass | 316.02418 |
| CLogP | 1.8459 |
| CLogS | -4.034 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 215.52 |
| Relative PSA | 0.42766 |
| PolarSurfaceArea | 109.38 |
| Druglikeness | -8.2994 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.47619 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(Z)-[5-sulfanylidene-3-(trifluoromethyl)-1H-1,2,4-triazol-4-yl]iminomethyl]benzoic acid | 2 - 2-[(Z)-[5-sulfanylidene-3-(trifluoromethyl)-1H-1,2,4-triazol-4-yl]iminomethyl]benzoic acid