| MolName | 4-[(Z)-(3-nitrophenyl)methylideneamino]-3-(trifluoromethyl)-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C10H6N5O2F3S |
| Smiles | [O-][N+](c1cccc(/C=N\N(C(C(F)(F)F)=NN2)C2=S)c1)=O |
| InChI | InChI=1S/C10H6F3N5O2S/c11-10(12,13)8-15-16-9(21)17(8)14-5-6-2-1-3-7(4-6)18(19)20/h1-5H,(H,16,21) |
| InChIK | MJTMKXSFTRVSNR-UHFFFAOYSA-N |
| TotalMolweight | 317.251 |
| Molweight | 317.251 |
| MonoisotopicMass | 317.019429 |
| CLogP | 1.4392 |
| CLogS | -4.481 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 215.09 |
| Relative PSA | 0.44842 |
| PolarSurfaceArea | 117.9 |
| Druglikeness | -13.33 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.52381 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-(3-nitrophenyl)methylideneamino]-3-(trifluoromethyl)-1H-1,2,4-triazole-5-thione | 2 - 4-[(Z)-(3-nitrophenyl)methylideneamino]-3-(trifluoromethyl)-1H-1,2,4-triazole-5-thione