| MolName | N-[(Z)-[4-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenyl]methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
| MolecularFormula | C30H40N14O4 |
| Smiles | C(COCC1)N1c1nc(N/N=C\c2ccc(/C=N\Nc3nc(N4CCOCC4)nc(N4CCOCC4)n3)cc2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C30H40N14O4/c1-2-24(22-32-40-26-35-29(43-9-17-47-18-10-43)38-30(36-26)44-11-19-48-20-12-44)4-3-23(1)21-31-39-25-33-27(41-5-13-45-14-6-41)37-28(34-25)42-7-15-46-16-8-42/h1-4,21-22H,5-20H2,(H,33,34,37,39)(H,35,36,38,40) |
| InChIK | MKEVYRLFJGVSQJ-UHFFFAOYSA-N |
| TotalMolweight | 660.742 |
| Molweight | 660.742 |
| MonoisotopicMass | 660.335696 |
| CLogP | 5.5414 |
| CLogS | -5.466 |
| H Acceptors | 18 |
| H Donors | 2 |
| TotalSurfaceArea | 505.14 |
| Relative PSA | 0.32854 |
| PolarSurfaceArea | 176 |
| Druglikeness | 3.2985 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 48 |
| NonCHAtoms | 18 |
| Electronegative Atoms | 18 |
| Rotatable Bond | 10 |
| Rings Closures | 7 |
| Small Rings | 7 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 20 |
| Symmetricatoms | 35 |
| Aromatic Nitrogens | 6 |
| BasicNitrogens | 6 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenyl]methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine | 2 - N-[(Z)-[4-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenyl]methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine