| MolName | N-[(Z)-2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| MolecularFormula | C18H18N2O3S |
| Smiles | O=C(c1cc(CCCC2)c2s1)N/N=C\c(cc1)cc2c1OCCO2 |
| InChI | InChI=1S/C18H18N2O3S/c21-18(17-10-13-3-1-2-4-16(13)24-17)20-19-11-12-5-6-14-15(9-12)23-8-7-22-14/h5-6,9-11H,1-4,7-8H2,(H,20,21) |
| InChIK | MKNRHHONTBNIOM-UHFFFAOYSA-N |
| TotalMolweight | 342.418 |
| Molweight | 342.418 |
| MonoisotopicMass | 342.103813 |
| CLogP | 4.286 |
| CLogS | -5.115 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 258.49 |
| Relative PSA | 0.29545 |
| PolarSurfaceArea | 88.16 |
| Druglikeness | -6.2424 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 8 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide | 2 - N-[(Z)-2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide