| MolName | (Z)-N-[(Z)-(2,3-dichlorophenyl)methylideneamino]fluoren-9-imine |
| MolecularFormula | C20H12N2Cl2 |
| Smiles | Clc(cccc1/C=N\N=C2c(cccc3)c3-c3c2cccc3)c1Cl |
| InChI | InChI=1S/C20H12Cl2N2/c21-18-11-5-6-13(19(18)22)12-23-24-20-16-9-3-1-7-14(16)15-8-2-4-10-17(15)20/h1-12H |
| InChIK | MKOUCGROVKLYDU-UHFFFAOYSA-N |
| TotalMolweight | 351.235 |
| Molweight | 351.235 |
| MonoisotopicMass | 350.037752 |
| CLogP | 7.5806 |
| CLogS | -8.38 |
| H Acceptors | 2 |
| TotalSurfaceArea | 257.85 |
| Relative PSA | 0.089277 |
| PolarSurfaceArea | 24.72 |
| Druglikeness | 1.9262 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 2 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-[(Z)-(2,3-dichlorophenyl)methylideneamino]fluoren-9-imine | 2 - (Z)-N-[(Z)-(2,3-dichlorophenyl)methylideneamino]fluoren-9-imine