| MolName | [1-[(Z)-[[2,2-bis(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2-chlorobenzoate |
| MolecularFormula | C32H21N2O5Cl3 |
| Smiles | O=C(C(Oc(cc1)ccc1Cl)Oc(cc1)ccc1Cl)N/N=C\c(c1ccccc1cc1)c1OC(c(cccc1)c1Cl)=O |
| InChI | InChI=1S/C32H21Cl3N2O5/c33-21-10-14-23(15-11-21)40-32(41-24-16-12-22(34)13-17-24)30(38)37-36-19-27-25-6-2-1-5-20(25)9-18-29(27)42-31(39)26-7-3-4-8-28(26)35/h1-19,32H,(H,37,38) |
| InChIK | MLTBCJZJHQCNPT-UHFFFAOYSA-N |
| TotalMolweight | 619.887 |
| Molweight | 619.887 |
| MonoisotopicMass | 618.051604 |
| CLogP | 8.4571 |
| CLogS | -10.056 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 447.62 |
| Relative PSA | 0.1766 |
| PolarSurfaceArea | 86.22 |
| Druglikeness | 4.2953 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.45238 |
| Fragments | 1 |
| Non HAtoms | 42 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 10 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 28 |
| Sp3Atoms | 4 |
| Symmetricatoms | 10 |
| StereoCon |
Click to Load Molecule:
1 - [1-[(Z)-[[2,2-bis(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2-chlorobenzoate | 2 - [1-[(Z)-[[2,2-bis(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 2-chlorobenzoate