| MolName | 4-N-benzyl-6-morpholin-4-yl-2-N-[(Z)-(3-nitrophenyl)methylideneamino]-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C21H22N8O3 |
| Smiles | [O-][N+](c1cc(/C=N\Nc2nc(N3CCOCC3)nc(NCc3ccccc3)n2)ccc1)=O |
| InChI | InChI=1S/C21H22N8O3/c30-29(31)18-8-4-7-17(13-18)15-23-27-20-24-19(22-14-16-5-2-1-3-6-16)25-21(26-20)28-9-11-32-12-10-28/h1-8,13,15H,9-12,14H2,(H2,22,24,25,26,27) |
| InChIK | MMCLRBFOWIKQCI-UHFFFAOYSA-N |
| TotalMolweight | 434.459 |
| Molweight | 434.459 |
| MonoisotopicMass | 434.181487 |
| CLogP | 3.5638 |
| CLogS | -5.281 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 336.01 |
| Relative PSA | 0.33127 |
| PolarSurfaceArea | 133.38 |
| Druglikeness | -1.6581 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.53125 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 7 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-N-benzyl-6-morpholin-4-yl-2-N-[(Z)-(3-nitrophenyl)methylideneamino]-1,3,5-triazine-2,4-diamine | 2 - 4-N-benzyl-6-morpholin-4-yl-2-N-[(Z)-(3-nitrophenyl)methylideneamino]-1,3,5-triazine-2,4-diamine