| MolName | 3-[(4-chlorophenyl)sulfamoyl]-N-[(Z)-(4-phenylphenyl)methylideneamino]benzamide |
| MolecularFormula | C26H20N3O3ClS |
| Smiles | O=C(c1cccc(S(Nc(cc2)ccc2Cl)(=O)=O)c1)N/N=C\c(cc1)ccc1-c1ccccc1 |
| InChI | InChI=1S/C26H20ClN3O3S/c27-23-13-15-24(16-14-23)30-34(32,33)25-8-4-7-22(17-25)26(31)29-28-18-19-9-11-21(12-10-19)20-5-2-1-3-6-20/h1-18,30H,(H,29,31) |
| InChIK | MMDPIQBOTSOOAX-UHFFFAOYSA-N |
| TotalMolweight | 489.982 |
| Molweight | 489.982 |
| MonoisotopicMass | 489.091389 |
| CLogP | 5.7659 |
| CLogS | -7.876 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 361.97 |
| Relative PSA | 0.2101 |
| PolarSurfaceArea | 96.01 |
| Druglikeness | 1.4865 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64706 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 1 |
| Symmetricatoms | 7 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(4-chlorophenyl)sulfamoyl]-N-[(Z)-(4-phenylphenyl)methylideneamino]benzamide | 2 - 3-[(4-chlorophenyl)sulfamoyl]-N-[(Z)-(4-phenylphenyl)methylideneamino]benzamide