| MolName | N-[2-[(2Z)-2-[(2-chlorophenyl)methylidene]hydrazinyl]-4-phenyl-1,3-thiazol-5-yl]benzamide |
| MolecularFormula | C23H17N4OClS |
| Smiles | O=C(c1ccccc1)Nc1c(-c2ccccc2)nc(N/N=C\c(cccc2)c2Cl)s1 |
| InChI | InChI=1S/C23H17ClN4OS/c24-19-14-8-7-13-18(19)15-25-28-23-26-20(16-9-3-1-4-10-16)22(30-23)27-21(29)17-11-5-2-6-12-17/h1-15H,(H,26,28)(H,27,29) |
| InChIK | MMKXZSIBWGMIJM-UHFFFAOYSA-N |
| TotalMolweight | 432.934 |
| Molweight | 432.934 |
| MonoisotopicMass | 432.081158 |
| CLogP | 8.1595 |
| CLogS | -7.058 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 328.09 |
| Relative PSA | 0.24018 |
| PolarSurfaceArea | 94.62 |
| Druglikeness | 3.9949 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.53333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Symmetricatoms | 4 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[2-[(2Z)-2-[(2-chlorophenyl)methylidene]hydrazinyl]-4-phenyl-1,3-thiazol-5-yl]benzamide | 2 - N-[2-[(2Z)-2-[(2-chlorophenyl)methylidene]hydrazinyl]-4-phenyl-1,3-thiazol-5-yl]benzamide