| MolName | N-(2-bromophenyl)-N'-[(Z)-thiophen-2-ylmethylideneamino]butanediamide |
| MolecularFormula | C15H14N3O2BrS |
| Smiles | O=C(CCC(N/N=C\c1cccs1)=O)Nc(cccc1)c1Br |
| InChI | InChI=1S/C15H14BrN3O2S/c16-12-5-1-2-6-13(12)18-14(20)7-8-15(21)19-17-10-11-4-3-9-22-11/h1-6,9-10H,7-8H2,(H,18,20)(H,19,21) |
| InChIK | MMSWRSDEMFNZTI-UHFFFAOYSA-N |
| TotalMolweight | 380.265 |
| Molweight | 380.265 |
| MonoisotopicMass | 378.999008 |
| CLogP | 3.6445 |
| CLogS | -4.909 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 258.29 |
| Relative PSA | 0.3131 |
| PolarSurfaceArea | 98.8 |
| Druglikeness | 3.4186 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68182 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-(2-bromophenyl)-N'-[(Z)-thiophen-2-ylmethylideneamino]butanediamide | 2 - N-(2-bromophenyl)-N'-[(Z)-thiophen-2-ylmethylideneamino]butanediamide