| MolName | 3-[(Z)-[(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenol |
| MolecularFormula | C18H23N7O |
| Smiles | Oc1cc(/C=N\Nc2nc(N3CCCC3)nc(N3CCCC3)n2)ccc1 |
| InChI | InChI=1S/C18H23N7O/c26-15-7-5-6-14(12-15)13-19-23-16-20-17(24-8-1-2-9-24)22-18(21-16)25-10-3-4-11-25/h5-7,12-13,26H,1-4,8-11H2,(H,20,21,22,23) |
| InChIK | MMURWQDCHJYWKX-UHFFFAOYSA-N |
| TotalMolweight | 353.429 |
| Molweight | 353.429 |
| MonoisotopicMass | 353.196408 |
| CLogP | 4.8988 |
| CLogS | -4.483 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 275.55 |
| Relative PSA | 0.2761 |
| PolarSurfaceArea | 89.77 |
| Druglikeness | 4.0845 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 9 |
| Symmetricatoms | 9 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-[(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenol | 2 - 3-[(Z)-[(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenol