| MolName | 1-[(Z)-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-3-(4-fluorophenyl)thiourea |
| MolecularFormula | C23H17N5BrFS |
| Smiles | Fc(cc1)ccc1NC(N/N=C\c1cn(-c2ccccc2)nc1-c(cc1)ccc1Br)=S |
| InChI | InChI=1S/C23H17BrFN5S/c24-18-8-6-16(7-9-18)22-17(15-30(29-22)21-4-2-1-3-5-21)14-26-28-23(31)27-20-12-10-19(25)11-13-20/h1-15H,(H2,27,28,31) |
| InChIK | MNBSLBSFFXUZLK-UHFFFAOYSA-N |
| TotalMolweight | 494.391 |
| Molweight | 494.391 |
| MonoisotopicMass | 493.037204 |
| CLogP | 5.3372 |
| CLogS | -6.982 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 345.87 |
| Relative PSA | 0.23208 |
| PolarSurfaceArea | 86.33 |
| Druglikeness | 0.88125 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.54839 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 1 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 1-[(Z)-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-3-(4-fluorophenyl)thiourea | 2 - 1-[(Z)-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-3-(4-fluorophenyl)thiourea