| MolName | N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| MolecularFormula | C18H12N6Cl2 |
| Smiles | Clc1cc(Cl)c(/C=N\Nc2cc(-c3ccccc3)nc3ncnn23)cc1 |
| InChI | InChI=1S/C18H12Cl2N6/c19-14-7-6-13(15(20)8-14)10-22-25-17-9-16(12-4-2-1-3-5-12)24-18-21-11-23-26(17)18/h1-11,25H |
| InChIK | MNNPRGNOTCKGQX-UHFFFAOYSA-N |
| TotalMolweight | 383.241 |
| Molweight | 383.241 |
| MonoisotopicMass | 382.050048 |
| CLogP | 5.7542 |
| CLogS | -4.64 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 281.37 |
| Relative PSA | 0.22685 |
| PolarSurfaceArea | 67.47 |
| Druglikeness | 4.9677 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.57692 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 4 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine | 2 - N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine