| MolName | N-benzyl-N-[(Z)-benzylideneamino]aniline |
| MolecularFormula | C20H18N2 |
| Smiles | C(c1ccccc1)N(c1ccccc1)/N=C\c1ccccc1 |
| InChI | InChI=1S/C20H18N2/c1-4-10-18(11-5-1)16-21-22(20-14-8-3-9-15-20)17-19-12-6-2-7-13-19/h1-16H,17H2 |
| InChIK | MNSMWDJATBUBDS-UHFFFAOYSA-N |
| TotalMolweight | 286.377 |
| Molweight | 286.377 |
| MonoisotopicMass | 286.146998 |
| CLogP | 4.9718 |
| CLogS | -4.302 |
| H Acceptors | 2 |
| TotalSurfaceArea | 241.6 |
| Relative PSA | 0.062334 |
| PolarSurfaceArea | 15.6 |
| Druglikeness | 4.0784 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.54545 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 2 |
| Electronegative Atoms | 2 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 1 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - N-benzyl-N-[(Z)-benzylideneamino]aniline | 2 - N-benzyl-N-[(Z)-benzylideneamino]aniline