| MolName | 2-[[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]ethanol |
| MolecularFormula | C17H14N3O5ClS |
| Smiles | OCCN(C(c1c2cccc1)=NS2(=O)=O)/N=C\c(cc1OCOc1c1)c1Cl |
| InChI | InChI=1S/C17H14ClN3O5S/c18-13-8-15-14(25-10-26-15)7-11(13)9-19-21(5-6-22)17-12-3-1-2-4-16(12)27(23,24)20-17/h1-4,7-9,22H,5-6,10H2 |
| InChIK | MNTMDCDRYQPWSU-UHFFFAOYSA-N |
| TotalMolweight | 407.833 |
| Molweight | 407.833 |
| MonoisotopicMass | 407.034269 |
| CLogP | 3.0735 |
| CLogS | -4.462 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 275.68 |
| Relative PSA | 0.32012 |
| PolarSurfaceArea | 109.17 |
| Druglikeness | 4.7321 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.48148 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 7 |
| Symmetricatoms | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]ethanol | 2 - 2-[[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]ethanol