| MolName | 2-[N-(benzenesulfonyl)-2-nitroanilino]-N-[(Z)-[4-[2-oxo-2-(oxolan-2-ylmethylamino)ethoxy]phenyl]methylideneamino]acetamide |
| MolecularFormula | C28H29N5O8S |
| Smiles | [O-][N+](c(cccc1)c1N(CC(N/N=C\c(cc1)ccc1OCC(NCC1OCCC1)=O)=O)S(c1ccccc1)(=O)=O)=O |
| InChI | InChI=1S/C28H29N5O8S/c34-27(19-32(25-10-4-5-11-26(25)33(36)37)42(38,39)24-8-2-1-3-9-24)31-30-17-21-12-14-22(15-13-21)41-20-28(35)29-18-23-7-6-16-40-23/h1-5,8-15,17,23H,6-7,16,18-20H2,(H,29,35)(H,31,34)/t23-/m1/s1 |
| InChIK | MOCCEECOVDESLE-HSZRJFAPSA-N |
| TotalMolweight | 595.631 |
| Molweight | 595.631 |
| MonoisotopicMass | 595.173685 |
| CLogP | 1.4427 |
| CLogS | -5.856 |
| H Acceptors | 13 |
| H Donors | 2 |
| TotalSurfaceArea | 440.07 |
| Relative PSA | 0.32508 |
| PolarSurfaceArea | 180.6 |
| Druglikeness | -7.6215 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54762 |
| Fragments | 1 |
| Non HAtoms | 42 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| StereoCenters | 1 |
| Rotatable Bond | 12 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 11 |
| Symmetricatoms | 5 |
| Amides | 2 |
| AcidicOxygens | 1 |
| StereoCon | racemate |
Click to Load Molecule:
1 - 2-[N-(benzenesulfonyl)-2-nitroanilino]-N-[(Z)-[4-[2-oxo-2-(oxolan-2-ylmethylamino)ethoxy]phenyl]methylideneamino]acetamide | 2 - 2-[N-(benzenesulfonyl)-2-nitroanilino]-N-[(Z)-[4-[2-oxo-2-(oxolan-2-ylmethylamino)ethoxy]phenyl]methylideneamino]acetamide